CAS 60538-18-3 appears in our catalog under these names: H-D-Allo-Thr-OMe hydrochloride, 96%, H–D–allo–Thr–OMe · HCl, H-D-allo-Threonine methyl ester hydrochloride, H-D-allo-Thr-OMe·HCl 97%, Methyl D-allo-threoninate hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 2000mg, 1000mg, 5000mg, 10000mg, 25000mg.
Methyl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride (CAS 60538-18-3) is a chemical compound with the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. IUPAC name: methyl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride. InChIKey: OZSJLLVVZFTDEY-VKKIDBQXSA-N.
| Molecular formula | C5H12ClNO3 |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | methyl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride |
| InChIKey | OZSJLLVVZFTDEY-VKKIDBQXSA-N |
| SMILES | C[C@H]([C@H](C(=O)OC)N)O.Cl |
Computed by PubChem (NCBI)