CAS 2231249-10-6 appears in our catalog under these names: (S)-2-Amino-3-hydroxy-3-methylbutanoic acid hydrochloride, 95%, (S)-2-Amino-3-hydroxy-3-methylbutanoic acid hcl, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg.
(2S)-2-amino-3-hydroxy-3-methylbutanoic acid;hydrochloride (CAS 2231249-10-6) is a chemical compound with the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. IUPAC name: (2S)-2-amino-3-hydroxy-3-methylbutanoic acid;hydrochloride. InChIKey: JWMNLDPWYMQUBU-AENDTGMFSA-N.
| Molecular formula | C5H12ClNO3 |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | (2S)-2-amino-3-hydroxy-3-methylbutanoic acid;hydrochloride |
| InChIKey | JWMNLDPWYMQUBU-AENDTGMFSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)