CAS 336182-14-0 appears in our catalog under these names: (3R,4R)-3-Amino-4-hydroxy-pentanoic acid hydrochloride, 95%, (3R,4R)–3–Amino–4–hydroxypentanoic acid hydrochloride, H-β-HoThr-OH·HCl 95%, (3R,4R)-3-Amino-4-hydroxypentanoic acid hydrochloride, 95%, 95%, (3R,4R)-3-Amino-4-hydroxypentanoic acid hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
(3R,4R)-3-amino-4-hydroxypentanoic acid;hydrochloride (CAS 336182-14-0) is a chemical compound with the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. IUPAC name: (3R,4R)-3-amino-4-hydroxypentanoic acid;hydrochloride. InChIKey: XFOXVGBKIZQZCB-VKKIDBQXSA-N.
| Molecular formula | C5H12ClNO3 |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | (3R,4R)-3-amino-4-hydroxypentanoic acid;hydrochloride |
| InChIKey | XFOXVGBKIZQZCB-VKKIDBQXSA-N |
| SMILES | C[C@H]([C@@H](CC(=O)O)N)O.Cl |
Computed by PubChem (NCBI)