CAS 60548-02-9 is the registry number for 6-(Benzyloxy)-2-chloro-7-methoxyquinazolin-4-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-7-methoxy-6-phenylmethoxyquinazolin-4-amine (CAS 60548-02-9) is a chemical compound with the molecular formula C16H14ClN3O2 and a molecular weight of 315.75 g/mol. IUPAC name: 2-chloro-7-methoxy-6-phenylmethoxyquinazolin-4-amine. InChIKey: VULUOYHJUMCHSH-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3O2 |
|---|---|
| Molecular weight | 315.75 g/mol |
| IUPAC name | 2-chloro-7-methoxy-6-phenylmethoxyquinazolin-4-amine |
| InChIKey | VULUOYHJUMCHSH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=C(N=C2N)Cl)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)