CAS 937597-74-5 is the registry number for 1-((4-Chlorophenyl)methyl)-3,6-dimethyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[(4-chlorophenyl)methyl]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid (CAS 937597-74-5) is a chemical compound with the molecular formula C16H14ClN3O2 and a molecular weight of 315.75 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid. InChIKey: LIWUKOYOBBJUTC-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3O2 |
|---|---|
| Molecular weight | 315.75 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid |
| InChIKey | LIWUKOYOBBJUTC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=NN(C2=N1)CC3=CC=C(C=C3)Cl)C)C(=O)O |
Computed by PubChem (NCBI)