CAS 956440-76-9 is the registry number for 2-((4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl)quinoline-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]quinoline-4-carboxylic acid (CAS 956440-76-9) is a chemical compound with the molecular formula C16H14ClN3O2 and a molecular weight of 315.75 g/mol. IUPAC name: 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]quinoline-4-carboxylic acid. InChIKey: ZZWQAHYMOUVCGN-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3O2 |
|---|---|
| Molecular weight | 315.75 g/mol |
| IUPAC name | 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]quinoline-4-carboxylic acid |
| InChIKey | ZZWQAHYMOUVCGN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=NC3=CC=CC=C3C(=C2)C(=O)O)C)Cl |
Computed by PubChem (NCBI)