Products 60561-75-3
CAS 60561-75-3 is the registry number for 2-((3-Chlorophenyl)amino)-2-phenylacetic acid, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
2-(3-chloroanilino)-2-phenylacetic acid (CAS 60561-75-3) is a chemical compound with the molecular formula C14H12ClNO2 and a molecular weight of 261.70 g/mol. IUPAC name: 2-(3-chloroanilino)-2-phenylacetic acid. InChIKey: BNCQAJOGWSGDNU-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO2 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 2-(3-chloroanilino)-2-phenylacetic acid |
| InChIKey | BNCQAJOGWSGDNU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
(3-Chloro-phenylamino)-phenyl-acetic acid, 2-((3-Chlorophenyl)amino)-2-phenylacetic acid, 2-(3-chloroanilino)-2-phenylacetic acid, (3-Chloroanilino)(phenyl)acetic acid, 2-(3-chloroanilino)-2-phenyl-acetic acid, 2-((3-Chlorophenyl)amino)-2-phenylaceticacid, I+/--[(3-Chlorophenyl)amino]benzeneacetic acid, Benzeneacetic acid, alpha-[(3-chlorophenyl)amino]-