CAS 60609-65-6 appears in our catalog under these names: 3',5'-Dimethyl-4'-methoxyacetophenone, 95%, 1–(4–Methoxy–3,5–Dimethylphenyl)Ethanone, 3',5'-Dimethyl-4'-methoxyacetophenone 98%, 3',5'-Dimethyl-4'-methoxyacetophenone, 97%, 3',5'-Dimethyl-4'-methoxyacetophenone, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 250mg.
1-(4-methoxy-3,5-dimethylphenyl)ethanone (CAS 60609-65-6) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 1-(4-methoxy-3,5-dimethylphenyl)ethanone. InChIKey: OZNRJDZKCCJUJO-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 1-(4-methoxy-3,5-dimethylphenyl)ethanone |
| InChIKey | OZNRJDZKCCJUJO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC)C)C(=O)C |
Computed by PubChem (NCBI)