CAS 607-28-3 appears in our catalog under these names: Isatin-3-oxime, 98%, 3-(Hydroxyimino)indolin-2-one, 95%, β–Isatoxime (for Metal Analysis), beta-Isatoxime [for Metal Analysis], >98.0%(HPLC)(T), 1H-Indole-2,3-dione, 3-oxime, 97%+(HPLC),RG, 97%+(HPLC),RG. Offered by: Combi-blocks, Fluorochem, GLPBio, TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 100g.
3-nitroso-1H-indol-2-ol (CAS 607-28-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 3-nitroso-1H-indol-2-ol. InChIKey: XXIJFHJUUXTXIX-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 3-nitroso-1H-indol-2-ol |
| InChIKey | XXIJFHJUUXTXIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)N=O |
Computed by PubChem (NCBI)