CAS 607-72-7 appears in our catalog under these names: 2-Methylquinolin-5-ol, 95+%, 2-Methylquinolin-5-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 5g.
2-methylquinolin-5-ol (CAS 607-72-7) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 2-methylquinolin-5-ol. InChIKey: SCDOECQNQZPWAJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 2-methylquinolin-5-ol |
| InChIKey | SCDOECQNQZPWAJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC=C2)O |
Computed by PubChem (NCBI)