Products 60722-14-7
CAS 60722-14-7 is the registry number for 2-Cyanobicyclo(2.2.1)hept-5-ene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS 60722-14-7) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: 2-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylic acid. InChIKey: KLMMYNMIJLTRCX-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | 2-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| InChIKey | KLMMYNMIJLTRCX-UHFFFAOYSA-N |
| SMILES | C1C2CC(C1C=C2)(C#N)C(=O)O |
Computed by PubChem (NCBI)