CAS 6076-13-7 appears in our catalog under these names: 4,5,6,7-Tetrahydro-1H-indazole-3-carboxylic acid, 97%, 4,5,6,7-Tetrahydro-1H-indazole-3-carboxylic acid 98%, 4,5,6,7-Tetrahydro-1H-indazole-3-carboxylic acid, 98%, 98%, 4,5,6,7-Tetrahydro-1 H -indazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid (CAS 6076-13-7) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid. InChIKey: LWXNHFZBFJMHGU-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid |
| InChIKey | LWXNHFZBFJMHGU-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)