Products 714255-28-4

CAS 714255-28-4 is the registry number for 4,5,6,7-Tetrahydro-2h-indazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid (CAS 714255-28-4) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid. InChIKey: LWXNHFZBFJMHGU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O2
Molecular weight166.18 g/mol
IUPAC name4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid
InChIKeyLWXNHFZBFJMHGU-UHFFFAOYSA-N
SMILESC1CCC2=C(C1)C(=NN2)C(=O)O

Computed by PubChem (NCBI)