Products 608-89-9
CAS 608-89-9 appears in our catalog under these names: Apixaban Impurity 20, Ethyl Acid Tartrate, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2R,3R)-4-ethoxy-2,3-dihydroxy-4-oxobutanoic acid (CAS 608-89-9) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: (2R,3R)-4-ethoxy-2,3-dihydroxy-4-oxobutanoic acid. InChIKey: ZUDZWKJBYZAGBS-QWWZWVQMSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | (2R,3R)-4-ethoxy-2,3-dihydroxy-4-oxobutanoic acid |
| InChIKey | ZUDZWKJBYZAGBS-QWWZWVQMSA-N |
| SMILES | CCOC(=O)[C@@H]([C@H](C(=O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
monoethyl tartrate, Tartaric acid, monoethyl ester, MONOETHYL TARTRATE [MI], Ethyl acid tartrate, Ethyl tartrate, acid, Varenicline Impurity 2, (2R,3R)-4-ethoxy-2,3-dihydroxy-4-oxobutanoic acid, Tartaric acid, ethyl ester, Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, 1-ethyl ester, Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, monoethyl ester