CAS 60838-60-0 is the registry number for 1H,1H,6H-Decafluorohexan-1-ol. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
2,2,3,3,4,4,5,5,6,6-decafluorohexan-1-ol (CAS 60838-60-0) is a chemical compound with the molecular formula C6H4F10O and a molecular weight of 282.08 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6-decafluorohexan-1-ol. InChIKey: DYJNIUWJUXNOOR-UHFFFAOYSA-N.
| Molecular formula | C6H4F10O |
|---|---|
| Molecular weight | 282.08 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6-decafluorohexan-1-ol |
| InChIKey | DYJNIUWJUXNOOR-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)