CAS 742063-29-2 is the registry number for 2,2,3,3,4,4,5,5-Octafluoropentyl difluoromethyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(difluoromethoxy)-1,1,2,2,3,3,4,4-octafluoropentane (CAS 742063-29-2) is a chemical compound with the molecular formula C6H4F10O and a molecular weight of 282.08 g/mol. IUPAC name: 5-(difluoromethoxy)-1,1,2,2,3,3,4,4-octafluoropentane. InChIKey: GGMPBPONEOPDTJ-UHFFFAOYSA-N.
| Molecular formula | C6H4F10O |
|---|---|
| Molecular weight | 282.08 g/mol |
| IUPAC name | 5-(difluoromethoxy)-1,1,2,2,3,3,4,4-octafluoropentane |
| InChIKey | GGMPBPONEOPDTJ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)F)(F)F)(F)F)(F)F)OC(F)F |
Computed by PubChem (NCBI)