CAS 65064-78-0 is the registry number for 1H,1H,2'H,3H-Decafluorodipropyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,1,1,2,3,3-hexafluoro-3-(2,2,3,3-tetrafluoropropoxy)propane (CAS 65064-78-0) is a chemical compound with the molecular formula C6H4F10O and a molecular weight of 282.08 g/mol. IUPAC name: 1,1,1,2,3,3-hexafluoro-3-(2,2,3,3-tetrafluoropropoxy)propane. InChIKey: DOESGSGKEZIPFW-UHFFFAOYSA-N.
| Molecular formula | C6H4F10O |
|---|---|
| Molecular weight | 282.08 g/mol |
| IUPAC name | 1,1,1,2,3,3-hexafluoro-3-(2,2,3,3-tetrafluoropropoxy)propane |
| InChIKey | DOESGSGKEZIPFW-UHFFFAOYSA-N |
| SMILES | C(C(C(F)F)(F)F)OC(C(C(F)(F)F)F)(F)F |
Computed by PubChem (NCBI)