CAS 6095-82-5 appears in our catalog under these names: 2,4,6-Trimethylphenyl isothiocyanate, 97%, 2,4,6–Trimethylphenyl isothiocyanate, 2,4,6-Trimethylphenyl Isothiocyanate, 2,4,6-Trimethylphenyl Isothiocyanate, >98.0%(GC), 2,4,6-Trimethylphenylisothiocyanate 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 2,5g, 0,25g, 100g.
2-isothiocyanato-1,3,5-trimethylbenzene (CAS 6095-82-5) is a chemical compound with the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. IUPAC name: 2-isothiocyanato-1,3,5-trimethylbenzene. InChIKey: KKYMYPLVBCVDPL-UHFFFAOYSA-N.
| Molecular formula | C10H11NS |
|---|---|
| Molecular weight | 177.27 g/mol |
| IUPAC name | 2-isothiocyanato-1,3,5-trimethylbenzene |
| InChIKey | KKYMYPLVBCVDPL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N=C=S)C |
Computed by PubChem (NCBI)