Products 745784-00-3
CAS 745784-00-3 appears in our catalog under these names: (R)-(+)-1-Phenylpropyl isothiocyanate, 97%, (R)-(+)-1-Phenylpropyl isothiocyanate, ≥97%, ≥97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 50mg.
[(1R)-1-isothiocyanatopropyl]benzene (CAS 745784-00-3) is a chemical compound with the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. IUPAC name: [(1R)-1-isothiocyanatopropyl]benzene. InChIKey: KLNMIWGOGGBFNV-SNVBAGLBSA-N.
| Molecular formula | C10H11NS |
|---|---|
| Molecular weight | 177.27 g/mol |
| IUPAC name | [(1R)-1-isothiocyanatopropyl]benzene |
| InChIKey | KLNMIWGOGGBFNV-SNVBAGLBSA-N |
| SMILES | CC[C@H](C1=CC=CC=C1)N=C=S |
Computed by PubChem (NCBI)