CAS 737001-04-6 is the registry number for (S)-(-)-1-Phenylpropyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[(1S)-1-isothiocyanatopropyl]benzene (CAS 737001-04-6) is a chemical compound with the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. IUPAC name: [(1S)-1-isothiocyanatopropyl]benzene. InChIKey: KLNMIWGOGGBFNV-JTQLQIEISA-N.
| Molecular formula | C10H11NS |
|---|---|
| Molecular weight | 177.27 g/mol |
| IUPAC name | [(1S)-1-isothiocyanatopropyl]benzene |
| InChIKey | KLNMIWGOGGBFNV-JTQLQIEISA-N |
| SMILES | CC[C@@H](C1=CC=CC=C1)N=C=S |
Computed by PubChem (NCBI)