CAS 60965-26-6 appears in our catalog under these names: 2-Bromo-2',4'-dimethoxyacetophenone, 95%, 2–Bromo–2',4'–dimethoxyacetophenone, 2-Bromo-2',4'-dimethoxyacetophenone, 98% , 2-Bromo-2',4'-dimethoxyacetophenone, >97.0%(GC), 2-Bromo-2',4'-dimethoxyacetophenone, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 1g, 5g, 200mg, 250mg, 25g.
2-bromo-1-(2,4-dimethoxyphenyl)ethanone (CAS 60965-26-6) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 2-bromo-1-(2,4-dimethoxyphenyl)ethanone. InChIKey: PKVBZABQCCQHLD-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 2-bromo-1-(2,4-dimethoxyphenyl)ethanone |
| InChIKey | PKVBZABQCCQHLD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)CBr)OC |
Computed by PubChem (NCBI)