Products 6098-50-6

CAS 6098-50-6 is the registry number for Dapoxetine Impurity 67. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-(dimethylamino)-3-phenylpropanoic acid (CAS 6098-50-6) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 3-(dimethylamino)-3-phenylpropanoic acid. InChIKey: JTKDHNKYUPVADI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO2
Molecular weight193.24 g/mol
IUPAC name3-(dimethylamino)-3-phenylpropanoic acid
InChIKeyJTKDHNKYUPVADI-UHFFFAOYSA-N
SMILESCN(C)C(CC(=O)O)C1=CC=CC=C1

Computed by PubChem (NCBI)