CAS 60999-76-0 is the registry number for 1-(4-Methoxy-2,6-dimethylphenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-methoxy-2,6-dimethylphenyl)ethanone (CAS 60999-76-0) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 1-(4-methoxy-2,6-dimethylphenyl)ethanone. InChIKey: LOQOGGQUEVRUSS-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 1-(4-methoxy-2,6-dimethylphenyl)ethanone |
| InChIKey | LOQOGGQUEVRUSS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)C)C)OC |
Computed by PubChem (NCBI)