CAS 610289-35-5 is the registry number for 1,4-Dimethyl-3-phenyl-1H-pyrazol-5-ol. Offered by: TRC. Available pack sizes: 10mg, 1mg.
2,4-dimethyl-5-phenyl-1H-pyrazol-3-one (CAS 610289-35-5) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 2,4-dimethyl-5-phenyl-1H-pyrazol-3-one. InChIKey: UNGLUSZBDNELBI-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 2,4-dimethyl-5-phenyl-1H-pyrazol-3-one |
| InChIKey | UNGLUSZBDNELBI-UHFFFAOYSA-N |
| SMILES | CC1=C(NN(C1=O)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)