CAS 61062-56-4 is the registry number for 2-amino-1-(3-(trifluoromethyl)phenyl)ethanone hcl. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-amino-1-[3-(trifluoromethyl)phenyl]ethanone;hydrochloride (CAS 61062-56-4) is a chemical compound with the molecular formula C9H9ClF3NO and a molecular weight of 239.62 g/mol. IUPAC name: 2-amino-1-[3-(trifluoromethyl)phenyl]ethanone;hydrochloride. InChIKey: HEPPSEJUYWXQJV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO |
|---|---|
| Molecular weight | 239.62 g/mol |
| IUPAC name | 2-amino-1-[3-(trifluoromethyl)phenyl]ethanone;hydrochloride |
| InChIKey | HEPPSEJUYWXQJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=O)CN.Cl |
Computed by PubChem (NCBI)