CAS 610758-40-2 is the registry number for 2–(4–fluorophenyl)–6–methoxychroman–4–one. Offered by: GLPBio. Available pack sizes: 1g, 5g.
2-(4-fluorophenyl)-6-methoxy-2,3-dihydrochromen-4-one (CAS 610758-40-2) is a chemical compound with the molecular formula C16H13FO3 and a molecular weight of 272.27 g/mol. IUPAC name: 2-(4-fluorophenyl)-6-methoxy-2,3-dihydrochromen-4-one. InChIKey: VARCHUJAXLHBPL-UHFFFAOYSA-N.
| Molecular formula | C16H13FO3 |
|---|---|
| Molecular weight | 272.27 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-6-methoxy-2,3-dihydrochromen-4-one |
| InChIKey | VARCHUJAXLHBPL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(CC2=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)