CAS 611-07-4 appears in our catalog under these names: 5-Chloro-2-nitrophenol 97%, 5-Chloro-2-nitrophenol, 97%, 97%, 5-Chloro-2-nitrophenol, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
5-chloro-2-nitrophenol (CAS 611-07-4) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 5-chloro-2-nitrophenol. InChIKey: MZDBQSFPAMTTIS-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO3 |
|---|---|
| Molecular weight | 173.55 g/mol |
| IUPAC name | 5-chloro-2-nitrophenol |
| InChIKey | MZDBQSFPAMTTIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)