CAS 611-94-9 appears in our catalog under these names: 4–Methoxybenzophenone, 4-Methoxybenzophenone, 98+% , 4-Benzoylanisole, 4-Methoxybenzophenone, >98.0%(GC), 4-Methoxybenzophenone, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 500g, 25g, 250g, 1000g, 10g, 1kg.
(4-methoxyphenyl)-phenylmethanone (CAS 611-94-9) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: (4-methoxyphenyl)-phenylmethanone. InChIKey: SWFHGTMLYIBPPA-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | (4-methoxyphenyl)-phenylmethanone |
| InChIKey | SWFHGTMLYIBPPA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)