Products 61151-62-0
CAS 61151-62-0 appears in our catalog under these names: 2-(3-Fluorophenyl)morpholine Hydrochloride, 2-(3-Fluorophenyl)morpholine hydrochloride, 98%. Offered by: TRC, AmBeed. Available pack sizes: 1g, 250mg.
2-(3-fluorophenyl)morpholine;hydrochloride (CAS 61151-62-0) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: 2-(3-fluorophenyl)morpholine;hydrochloride. InChIKey: LIDDNGVAZFEPIN-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 2-(3-fluorophenyl)morpholine;hydrochloride |
| InChIKey | LIDDNGVAZFEPIN-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)