CAS 612-35-1 appears in our catalog under these names: 2–Benzylbenzoic acid, 2-Benzylbenzoic Acid, >95.0%(GC), ±-Phenyl-o-toluic acid, 2-Benzylbenzoic acid 98%, α-Phenyl-o-toluic acid, 98%, 98%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 100g, 500g, 1g, 10mM/1mL, 100 g.
2-benzylbenzoic acid (CAS 612-35-1) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 2-benzylbenzoic acid. InChIKey: FESDHLLVLYZNFY-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 2-benzylbenzoic acid |
| InChIKey | FESDHLLVLYZNFY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)