Products 61240-34-4
CAS 61240-34-4 is the registry number for Denudadione C. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 1 mg, 5 mg, 10 mg.
(1R,5R,6R,7R)-7-(1,3-benzodioxol-5-yl)-3-methoxy-6-methyl-5-prop-2-enylbicyclo[3.2.1]oct-3-ene-2,8-dione (CAS 61240-34-4) is a chemical compound with the molecular formula C20H20O5 and a molecular weight of 340.4 g/mol. IUPAC name: (1R,5R,6R,7R)-7-(1,3-benzodioxol-5-yl)-3-methoxy-6-methyl-5-prop-2-enylbicyclo[3.2.1]oct-3-ene-2,8-dione. InChIKey: YCTWRMSXONXESR-NBSNSOTFSA-N.
| Molecular formula | C20H20O5 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (1R,5R,6R,7R)-7-(1,3-benzodioxol-5-yl)-3-methoxy-6-methyl-5-prop-2-enylbicyclo[3.2.1]oct-3-ene-2,8-dione |
| InChIKey | YCTWRMSXONXESR-NBSNSOTFSA-N |
| SMILES | C[C@@H]1[C@H]([C@H]2C(=O)C(=C[C@@]1(C2=O)CC=C)OC)C3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)
Synonyms:
Denudadione C