CAS 612492-27-0 is the registry number for rac-4,12-Dihydroxy[2.2]paracyclophane, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 500mg.
Tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-diol (CAS 612492-27-0) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-diol. InChIKey: DLQLWHBZCGQDBL-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-diol |
| InChIKey | DLQLWHBZCGQDBL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(CCC3=C(C=C1C=C3)O)C=C2)O |
Computed by PubChem (NCBI)