Products 612832-83-4
CAS 612832-83-4 appears in our catalog under these names: 2-Benzyloxy-5-chlorobenzeneboronic acid, 95-<97%, 2-Benzyloxy-5-chlorobenzeneboronic acid, ≥97-<99%, 2–Benzyloxy–5–chlorophenylboronic Acid (contains varying amounts of Anhydride), 2-Benzyloxy-5-chlorophenylboronic Acid (contains varying amounts of Anhydride), (2-(Benzyloxy)-5-chlorophenyl)boronic acid, 96%, 96%. Offered by: Hoffman Fine Chemicals, GLPBio, TCI, Chemat, Ambeed. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 5g.
(5-chloro-2-phenylmethoxyphenyl)boronic acid (CAS 612832-83-4) is a chemical compound with the molecular formula C13H12BClO3 and a molecular weight of 262.50 g/mol. IUPAC name: (5-chloro-2-phenylmethoxyphenyl)boronic acid. InChIKey: SLERXVFZNNSBIX-UHFFFAOYSA-N.
| Molecular formula | C13H12BClO3 |
|---|---|
| Molecular weight | 262.50 g/mol |
| IUPAC name | (5-chloro-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | SLERXVFZNNSBIX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Benzyloxy-5-chlorobenzeneboronic acid, 2-Benzyloxy-5-chlorophenylboronic Acid (contains varying amounts of Anhydride), (2-(Benzyloxy)-5-chlorophenyl)boronic acid, (5-chloro-2-phenylmethoxyphenyl)boronic acid, 2-(benzyloxy)-5-chlorophenylboronic acid, [2-(Benzyloxy)-5-chlorophenyl]boronic acid, 2-benzyloxy-5-chloro-phenylboronic acid, {5-chloro-2-[(phenylmethyl)oxy]phenyl}boronic acid, Boronic acid, [5-chloro-2-(phenylmethoxy)phenyl]-, (2-(Benzyloxy)-5-chlorophenyl)boronicacid