Products 61324-91-2
CAS 61324-91-2 is the registry number for 4-Fluoro-N,N-dimethyl-3-nitrobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-fluoro-N,N-dimethyl-3-nitrobenzenesulfonamide (CAS 61324-91-2) is a chemical compound with the molecular formula C8H9FN2O4S and a molecular weight of 248.23 g/mol. IUPAC name: 4-fluoro-N,N-dimethyl-3-nitrobenzenesulfonamide. InChIKey: JNBSDOVFCHSPJE-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O4S |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 4-fluoro-N,N-dimethyl-3-nitrobenzenesulfonamide |
| InChIKey | JNBSDOVFCHSPJE-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)