CAS 61344-30-7 appears in our catalog under these names: 5-(4-tert-Butylphenyl)-5-methylimidazolidine-2,4-dione, 95%, 5-(4-tert-Butylphenyl)-5-methylimidazolidine-2,4-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
5-(4-tert-butylphenyl)-5-methylimidazolidine-2,4-dione (CAS 61344-30-7) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: 5-(4-tert-butylphenyl)-5-methylimidazolidine-2,4-dione. InChIKey: JKYLQCKSQSXCHN-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | 5-(4-tert-butylphenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | JKYLQCKSQSXCHN-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)