Products 887584-21-6
CAS 887584-21-6 appears in our catalog under these names: tert-Butyl 6-(aminomethyl)-1h-indole-1-carboxylate, 95%, tert-Butyl 6-(aminomethyl)-1h-indole-1-carboxylate hydrochloride, 95%, tert-Butyl 6-(Aminomethyl)-1H-indole-1-carboxylate. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 500mg, 1g.
Tert-butyl 6-(aminomethyl)indole-1-carboxylate (CAS 887584-21-6) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: tert-butyl 6-(aminomethyl)indole-1-carboxylate. InChIKey: SZLIIVBURSHWCK-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | tert-butyl 6-(aminomethyl)indole-1-carboxylate |
| InChIKey | SZLIIVBURSHWCK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=C(C=C2)CN |
Computed by PubChem (NCBI)