CAS 888972-65-4 is the registry number for (S)-1-Benzyl-3-propylpiperazine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3S)-1-benzyl-3-propylpiperazine-2,5-dione (CAS 888972-65-4) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: (3S)-1-benzyl-3-propylpiperazine-2,5-dione. InChIKey: NRVVVSMDLOPXJD-LBPRGKRZSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (3S)-1-benzyl-3-propylpiperazine-2,5-dione |
| InChIKey | NRVVVSMDLOPXJD-LBPRGKRZSA-N |
| SMILES | CCC[C@H]1C(=O)N(CC(=O)N1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)