CAS 614-34-6 appears in our catalog under these names: P-Tolyl benzoate, 95%, p-Tolyl Benzoate, >98.0%(GC), 4-METHYLPHENYL BENZOATE, 98%, 98%. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 25g, 5g, 100mg, 250mg, 500mg, 1g.
(4-methylphenyl) benzoate (CAS 614-34-6) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: (4-methylphenyl) benzoate. InChIKey: LLRZUDIHEZXFGV-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | (4-methylphenyl) benzoate |
| InChIKey | LLRZUDIHEZXFGV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)