CAS 61432-71-1 appears in our catalog under these names: Bisabola–3,10–dien–2–one, Bisabola-3,10-dien-2-one. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
(6R)-3-methyl-6-[(2S)-6-methylhept-5-en-2-yl]cyclohex-2-en-1-one (CAS 61432-71-1) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (6R)-3-methyl-6-[(2S)-6-methylhept-5-en-2-yl]cyclohex-2-en-1-one. InChIKey: KNOUERLLBMJGLF-UONOGXRCSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (6R)-3-methyl-6-[(2S)-6-methylhept-5-en-2-yl]cyclohex-2-en-1-one |
| InChIKey | KNOUERLLBMJGLF-UONOGXRCSA-N |
| SMILES | CC1=CC(=O)[C@H](CC1)[C@@H](C)CCC=C(C)C |
Computed by PubChem (NCBI)