CAS 6144-81-6 appears in our catalog under these names: 2-(4-Nitrophenyl)acetohydrazide, 95%, 2-(4-Nitrophenyl)acetohydrazide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
2-(4-nitrophenyl)acetohydrazide (CAS 6144-81-6) is a chemical compound with the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. IUPAC name: 2-(4-nitrophenyl)acetohydrazide. InChIKey: JFONGQRKKZPXLX-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 2-(4-nitrophenyl)acetohydrazide |
| InChIKey | JFONGQRKKZPXLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)