CAS 616-55-7 appears in our catalog under these names: 4,6-Di-tert-butyl-2-methylphenol, 2,4-Di-tert-butyl-6-methylphenol, 98%, 98%. Offered by: Dr. Ehrenstorfer, Chemat. Available pack sizes: 100mg, 5mg, 25mg, 50mg, 250mg.
2,4-ditert-butyl-6-methylphenol (CAS 616-55-7) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: 2,4-ditert-butyl-6-methylphenol. InChIKey: ZZZRZBIPCKQDQR-UHFFFAOYSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | 2,4-ditert-butyl-6-methylphenol |
| InChIKey | ZZZRZBIPCKQDQR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)