CAS 616-75-1 appears in our catalog under these names: Benzylmalonic acid, 98%, Benzylmalonic acid, Benzylmalonic Acid, >98.0%(GC)(T), 2-Benzylmalonic acid 98%, 2-Benzylmalonic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 50g, 100g, 250g, 10g.
2-benzylpropanedioic acid (CAS 616-75-1) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-benzylpropanedioic acid. InChIKey: JAEJSNFTJMYIEF-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-benzylpropanedioic acid |
| InChIKey | JAEJSNFTJMYIEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)