Products 61700-61-6
CAS 61700-61-6 appears in our catalog under these names: 2H-Indazole-5-carboxylic acid, 97%, 1H-Indazole-5-carboxylic acid, 97%, 1–H–indazole–5–carboxyle acid, 1H-Indazole-5-carboxylic acid, 98%, 1H-Indazole-5-carboxylic acid 97 %. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Acros), Ambeed, BLDpharm. Available pack sizes: 1g, 25g, 500g, 100g, 5g, 10g, 250mg.
1H-indazole-5-carboxylic acid (CAS 61700-61-6) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-5-carboxylic acid. InChIKey: MAVGBUDLHOOROM-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-5-carboxylic acid |
| InChIKey | MAVGBUDLHOOROM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C=NN2 |
Computed by PubChem (NCBI)