Products 617690-98-9
CAS 617690-98-9 is the registry number for SK-7041. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(dimethylamino)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]benzamide (CAS 617690-98-9) is a chemical compound with the molecular formula C19H21N3O3 and a molecular weight of 339.4 g/mol. IUPAC name: 4-(dimethylamino)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]benzamide. InChIKey: WWMASNYTEATYTC-KPKJPENVSA-N.
| Molecular formula | C19H21N3O3 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 4-(dimethylamino)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]benzamide |
| InChIKey | WWMASNYTEATYTC-KPKJPENVSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)NCC2=CC=C(C=C2)/C=C/C(=O)NO |
Computed by PubChem (NCBI)