CAS 61770-00-1 appears in our catalog under these names: 4,6-Dichloro-N,N,5-trimethylpyrimidin-2-amine, 95%, 4,6-Dichloro-N,N,5-trimethylpyrimidin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 0,5g, 50mg.
4,6-dichloro-N,N,5-trimethylpyrimidin-2-amine (CAS 61770-00-1) is a chemical compound with the molecular formula C7H9Cl2N3 and a molecular weight of 206.07 g/mol. IUPAC name: 4,6-dichloro-N,N,5-trimethylpyrimidin-2-amine. InChIKey: JYFSQUKOJVZDJE-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3 |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 4,6-dichloro-N,N,5-trimethylpyrimidin-2-amine |
| InChIKey | JYFSQUKOJVZDJE-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N=C1Cl)N(C)C)Cl |
Computed by PubChem (NCBI)