CAS 61885-22-1 is the registry number for 1,5-Dimethyl-4-nitro-1,2-dihydro-3H-pyrazol-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dimethyl-4-nitro-1H-pyrazol-5-one (CAS 61885-22-1) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. IUPAC name: 2,3-dimethyl-4-nitro-1H-pyrazol-5-one. InChIKey: NQDGRFWJFDMVPD-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O3 |
|---|---|
| Molecular weight | 157.13 g/mol |
| IUPAC name | 2,3-dimethyl-4-nitro-1H-pyrazol-5-one |
| InChIKey | NQDGRFWJFDMVPD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NN1C)[N+](=O)[O-] |
Computed by PubChem (NCBI)