CAS 619-10-3 appears in our catalog under these names: 2-Chloro-5-nitrophenol, 2–Chloro–5–nitrophenol, 2-Chloro-5-nitrophenol, >98.0%(GC)(T), 2-Chloro-5-nitrophenol, 98%, 2-Chloro-5-nitrophenol 98%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 500g.
2-chloro-5-nitrophenol (CAS 619-10-3) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 2-chloro-5-nitrophenol. InChIKey: BUMGQSCPTLELLS-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO3 |
|---|---|
| Molecular weight | 173.55 g/mol |
| IUPAC name | 2-chloro-5-nitrophenol |
| InChIKey | BUMGQSCPTLELLS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])O)Cl |
Computed by PubChem (NCBI)