Products 61946-89-2

CAS 61946-89-2 is the registry number for 4-Ethoxy-N-hydroxybenzimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-ethoxy-N-hydroxybenzenecarboximidoyl chloride (CAS 61946-89-2) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 4-ethoxy-N-hydroxybenzenecarboximidoyl chloride. InChIKey: CPKIZIAWOUQFDE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO2
Molecular weight199.63 g/mol
IUPAC name4-ethoxy-N-hydroxybenzenecarboximidoyl chloride
InChIKeyCPKIZIAWOUQFDE-UHFFFAOYSA-N
SMILESCCOC1=CC=C(C=C1)C(=NO)Cl

Computed by PubChem (NCBI)