Products 620-86-0
CAS 620-86-0 appears in our catalog under these names: Diphenylmethane-4-carboxylic acid, 95%, Diphenylmethane-4-carboxylic acid, 4-Benzylbenzoic acid 98%, Diphenylmethane-4-carboxylic acid, 98%, 98%, Diphenylmethane-4-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2g, 10g, 25g, 250mg.
4-benzylbenzoic acid (CAS 620-86-0) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 4-benzylbenzoic acid. InChIKey: FPHVRPCVNPHPBH-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 4-benzylbenzoic acid |
| InChIKey | FPHVRPCVNPHPBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)