Products 62004-05-1
CAS 62004-05-1 appears in our catalog under these names: Leflunomide Impurity 3, Teriflunomide Impurity 3, 2-Cyano-3-hydroxy-N-(3-(trifluoromethyl)phenyl)-2-butenamide. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-cyano-3-hydroxy-N-[3-(trifluoromethyl)phenyl]but-2-enamide (CAS 62004-05-1) is a chemical compound with the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. IUPAC name: 2-cyano-3-hydroxy-N-[3-(trifluoromethyl)phenyl]but-2-enamide. InChIKey: UJBZHNQIBVHDDU-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2 |
|---|---|
| Molecular weight | 270.21 g/mol |
| IUPAC name | 2-cyano-3-hydroxy-N-[3-(trifluoromethyl)phenyl]but-2-enamide |
| InChIKey | UJBZHNQIBVHDDU-UHFFFAOYSA-N |
| SMILES | CC(=C(C#N)C(=O)NC1=CC=CC(=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)